| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | TETRAHYDROCORTISOL Basic information |
| Product Name: | TETRAHYDROCORTISOL | | Synonyms: | SOLVENT A, TETRAHYDROFURAN;UROCORTISOL;TETRAMETHYLENE OXIDE;3-ALPHA,11-BETA,17-ALPHA,21-TETRAHYDROXY-5-BETA-PREGNAN-20-ONE;3-alpha,11-beta,17,21-tetrahydroxy-5-beta-pregnan-20-one;5-beta-tetrahydrocortisol;ba2682;tetrahydrof | | CAS: | 53-02-1 | | MF: | C21H34O5 | | MW: | 366.49 | | EINECS: | 200-159-8 | | Product Categories: | | | Mol File: | 53-02-1.mol |  |
| | TETRAHYDROCORTISOL Chemical Properties |
| Melting point | −108 °C(lit.) | | Boiling point | 65-67 °C(lit.) | | density | 0.889 g/mL at 25 °C(lit.) | | vapor density | 2.5 (vs air) | | vapor pressure | 114 mm Hg ( 15 °C) | | refractive index | n20/D 1.407(lit.) | | Fp | 1 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Very Slightly, Heated, Sonicated), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.48±0.70(Predicted) | | color | <10(APHA) | | Stability: | Hygroscopic | | InChIKey | AODPIQQILQLWGS-GXBDJPPSSA-N | | SMILES | O=C(CO)[C@@]1(O)CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])[C@@H](O)C[C@@]21C |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37-40 | | Safety Statements | 26-36-36/37 | | RIDADR | UN 2056 3/PG 2 | | WGK Germany | 1 | | RTECS | LU5950000 | | F | 3-10-23 | | Storage Class | 11 - Combustible Solids |
| | TETRAHYDROCORTISOL Usage And Synthesis |
| Uses | Tetrahydrocortisol is excreted in large amounts in premenopausal patients with early breast cancer. Tetrahydrocortisol has been found to be produced by lymphocytes in both normal and cancer bearing patients however, the concentration of Tetrahydrocortisol has increased in patients with cancer. | | Definition | ChEBI: Tetrahydrocortisol is a 3alpha-hydroxy steroid, an 11beta-hydroxy steroid, a 17alpha-hydroxy steroid, a 21-hydroxy steroid, a 20-oxo steroid, a glucocorticoid, a primary alpha-hydroxy ketone and a tertiary alpha-hydroxy ketone. It derives from a hydride of a 5beta-pregnane. | | IC 50 | Human Endogenous Metabolite |
| | TETRAHYDROCORTISOL Preparation Products And Raw materials |
|