|
|
| | ALLOTETRAHYDROCORTISOL Basic information |
| | ALLOTETRAHYDROCORTISOL Chemical Properties |
| Melting point | 253-255°C | | alpha | D21 +59.7° (c = 0.34 in methanol) | | density | 1.205g/cm3 | | storage temp. | Refrigerator | | solubility | Ethanol (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | color | White | | Stability: | Hygroscopic | | InChIKey | AODPIQQILQLWGS-FDSHTENPSA-N | | SMILES | C[C@@]12CC[C@H](O)C[C@H]1CC[C@@H]3[C@H]4CC[C@@](O)(C(=O)CO)[C@@]4(C)C[C@@H](O)[C@@H]23 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Skin Sens. 1 |
| | ALLOTETRAHYDROCORTISOL Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Cortisol (H714615). | | Definition | ChEBI: 5a-Tetrahydrocortisol is a corticosteroid hormone. | | IC 50 | Human Endogenous Metabolite |
| | ALLOTETRAHYDROCORTISOL Preparation Products And Raw materials |
|