- 1-CYANO-2-BROMO-5-NITROBENZENE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:134604-07-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Bromo-5-nitrobenzonitrile Basic information |
| | 2-Bromo-5-nitrobenzonitrile Chemical Properties |
| Melting point | 118-120 °C | | Boiling point | 321.1±32.0 °C(Predicted) | | density | 1.81±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | Appearance | White to off-white Solid | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C7H3BrN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H | | InChIKey | RKODNVITKISFKU-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC([N+]([O-])=O)=CC=C1Br |
| Hazard Codes | Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37-60 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids |
| | 2-Bromo-5-nitrobenzonitrile Usage And Synthesis |
| Chemical Properties | Type of white crystal | | Uses | 2-Bromo-5-nitrobenzonitrile is a benzonitrile derivative. The bromine atom on its benzene ring can be used in substitution reactions; the nitro group can be used in reductive amination or sulfonation reactions. This product is widely used in organic synthesis to prepare other heterocyclic compounds. |
| | 2-Bromo-5-nitrobenzonitrile Preparation Products And Raw materials |
|