| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(Bromomethyl)biphenyl Basic information |
| | 3-(Bromomethyl)biphenyl Chemical Properties |
| Melting point | 57-61 °C | | Boiling point | 185°C/12mm | | density | 1.341±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform, Methanol | | form | Solid | | color | Tan | | InChI | InChI=1S/C13H11Br/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-9H,10H2 | | InChIKey | RTFPTPXBTIUISM-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=CC(CBr)=C1 | | CAS DataBase Reference | 14704-31-5(CAS DataBase Reference) |
| Hazard Codes | C,N,Xi | | Risk Statements | 22-34-50/53-36/37/38 | | Safety Statements | 26-36/37/39-45-60-61-37/39 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | IRRITANT, LACHRYMATOR, CORROSIVE | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Corr. 1B |
| | 3-(Bromomethyl)biphenyl Usage And Synthesis |
| Chemical Properties | offwhite to light yellow crystal powder | | Uses | 3-Phenylbenzyl bromide may be used in the synthesis of the following amino alcohols:
- NH-benzyl-(1R,2S)-norephedrine
- NH-3-phenylbenzyl-(1R,2S)-norephedrine
- (1R,2S)-2-(benzylamino)-1,2-diphenylethanol
|
| | 3-(Bromomethyl)biphenyl Preparation Products And Raw materials |
|
|
Tag:3-(Bromomethyl)biphenyl(14704-31-5)
Related Product Information
|
|
Pentafluorobenzaldehyde
Benzyltriphenylphosphonium bromide
3'-Bromomethyl-3,4-dimethoxybiphenyl
3-(Bromomethyl)biphenyl
8-Bromomethylfluoranthene
2,3,4,5,6-pentafluorobenzaldehyde (6-chloro-3-pyridazinyl)hydrazone
2,3,4,5,6-pentafluorobenzaldehyde [4-(3,4-dimethoxyphenyl)-6-phenyl-2-pyrimidinyl]hydrazone
2,3,4,5,6-pentafluorobenzaldehyde (3-chloro-2-pyrazinyl)hydrazone
2,3,4,5,6-Pentafluorobenzaldehyde O-[(pentafluorophenyl)methyl]oxime
2,3,4,5,6-pentafluorobenzaldehyde [4-(4-bromophenyl)-6-phenyl-2-pyrimidinyl]hydrazone
2,3,4,5,6-pentafluorobenzaldehyde [6-(4-methyl-1H-pyrazol-1-yl)-4-pyrimidinyl]hydrazone
2,3,4,5,6-pentafluorobenzaldehyde [4,6-di(1-piperidinyl)-1,3,5-triazin-2-yl]hydrazone
(2-methoxy(5-phenyl)phenyl)methylbromide
2,3,4,5,6-Pentafluorobenzaldehyde 2,3,4,5,6-pentafluorophenyl hydrazone
2-Bromomethylfluoranthene
Pentafluorobenzaldehyde oxime
2,3,4,5,6-Pentafluorobenzaldehyde (4,6-dianilino-1,3,5-triazin-2-yl)hydrazone
2,3,4,5,6-Pentafluorobenzaldehyde 1,3-benzothiazol-2-ylhydrazone
|