| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | HYDRAZINE SULFATE (15N2) Basic information |
| | HYDRAZINE SULFATE (15N2) Chemical Properties |
| Melting point | 254 °C (lit.) | | density | 1.391 g/mL at 25 °C | | solubility | DMSO (Slightly, Heated), Water (Sparingly, Heated) | | form | Solid | | color | White to Off-White | | InChI | 1S/H4N2.H2O4S/c1-2;1-5(2,3)4/h1-2H2;(H2,1,2,3,4)/i1+1,2+1; | | InChIKey | ZGCHATBSUIJLRL-AWQJXPNKSA-N | | SMILES | [15NH2][15NH2].OS(O)(=O)=O | | CAS Number Unlabeled | 10034-93-2 |
| Hazard Codes | T,N | | Risk Statements | 45-23/24/25-43-50/53 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 2923 8/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 1B
Eye Dam. 1
Skin Corr. 1B
Skin Sens. 1 |
| | HYDRAZINE SULFATE (15N2) Usage And Synthesis |
| Uses | (Hydrazine sulfate-15N2) Isotope labelled Hydrazine Sulfate, is a reagent used in the heterocyclization of primary amines and may be cyclized itself. It is also used in the synthesis of novel triazole corrosion inhibitors for mild steel. |
| | HYDRAZINE SULFATE (15N2) Preparation Products And Raw materials |
|