1-PHENYL-1,3,3-TRIMETHYLINDAN manufacturers
|
| | 1-PHENYL-1,3,3-TRIMETHYLINDAN Basic information |
| Product Name: | 1-PHENYL-1,3,3-TRIMETHYLINDAN | | Synonyms: | 1-Phenyl-1,3,3-trimethylindane;1,1,3-trimethyl-3-phenyl-2H-indene;1,3,3-TriMethyl-1-Phenylindine;1-PHENYL-1,3,3-TRIMETHYLINDAN;1,1,3-trimethyl-3-phenylindane;1,1,3-trimethyl-3-phenylindan;1,3,3-Trimethyl-1-phenylindane;2,3-dihydro-1,1,3-trimethyl-3-phenyl-1h-inden | | CAS: | 3910-35-8 | | MF: | C18H20 | | MW: | 236.35 | | EINECS: | 223-467-4 | | Product Categories: | | | Mol File: | 3910-35-8.mol |  |
| | 1-PHENYL-1,3,3-TRIMETHYLINDAN Chemical Properties |
| Melting point | 52.5°C | | Boiling point | 313.82°C (rough estimate) | | density | 1.0009 | | refractive index | 1.5681 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane; Ethyl Acetate | | form | Solid | | color | Brown | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C18H20/c1-17(2)13-18(3,14-9-5-4-6-10-14)16-12-8-7-11-15(16)17/h4-12H,13H2,1-3H3 | | InChIKey | ICLPNZMYHDVKKI-UHFFFAOYSA-N | | SMILES | C1(C)(C)C2=C(C=CC=C2)C(C)(C2=CC=CC=C2)C1 | | LogP | 5.715 (est) | | EPA Substance Registry System | 1H-Indene, 2,3-dihydro-1,1,3-trimethyl-3-phenyl- (3910-35-8) |
| | 1-PHENYL-1,3,3-TRIMETHYLINDAN Usage And Synthesis |
| Uses | 1,1,3-Trimethyl-3-phenylindan is an intermediate in the synthesis of OctaInd (O237100). OctaInd is a commercial brominated flame retardant (BFR) used in styrenic and engineering thermoplastics. |
| | 1-PHENYL-1,3,3-TRIMETHYLINDAN Preparation Products And Raw materials |
|