|
|
| | 3-(4-Bromophenyl)piperidine-2,6-dione Basic information |
| Product Name: | 3-(4-Bromophenyl)piperidine-2,6-dione | | Synonyms: | 2,6-Piperidinedione, 3-(4-bromophenyl)-;3-(4-BROMOPHENYL)PIPERIDINE-2,6-DIONE;3-(4-Bromophenyl)-2,6-piperidinedione;3-(4-Bromophenyl)piperidin-2,6-dione;CRBN ligand-880;tert-Butyl (S)-3-(4-(7-(tert-butylcarbamoyl)-2H-indol-2-yl)phenyl)piperidine-1-carboxylate | | CAS: | 1267337-47-2 | | MF: | C11H10BrNO2 | | MW: | 268.11 | | EINECS: | | | Product Categories: | | | Mol File: | 1267337-47-2.mol |  |
| | 3-(4-Bromophenyl)piperidine-2,6-dione Chemical Properties |
| Boiling point | 434.9±45.0 °C(Predicted) | | density | 1.524±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 11.22±0.40(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C11H10BrNO2/c12-8-3-1-7(2-4-8)9-5-6-10(14)13-11(9)15/h1-4,9H,5-6H2,(H,13,14,15) | | InChIKey | YPICLEOQEVPRGE-UHFFFAOYSA-N | | SMILES | N1C(=O)CCC(C2=CC=C(Br)C=C2)C1=O |
| | 3-(4-Bromophenyl)piperidine-2,6-dione Usage And Synthesis |
| | 3-(4-Bromophenyl)piperidine-2,6-dione Preparation Products And Raw materials |
|