|
|
| | 2-Aminophenol-N,O-diacetate Basic information |
| Product Name: | 2-Aminophenol-N,O-diacetate | | Synonyms: | (2-acetamidophenyl) acetate;(2-acetamidophenyl) ethanoate;acetic acid (2-acetamidophenyl) ester;AcetaMide,N-[2-(acetyloxy)phenyl]-;2-Aminophenol-N,O-diacetate | | CAS: | 5467-64-1 | | MF: | C10H11NO3 | | MW: | 193.2 | | EINECS: | | | Product Categories: | | | Mol File: | 5467-64-1.mol |  |
| | 2-Aminophenol-N,O-diacetate Chemical Properties |
| Melting point | 122-124 °C | | Boiling point | 369.2±25.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | pka | 14.37±0.70(Predicted) | | InChI | InChI=1S/C10H11NO3/c1-7(12)11-9-5-3-4-6-10(9)14-8(2)13/h3-6H,1-2H3,(H,11,12) | | InChIKey | UGTVVIHMAMPKJT-UHFFFAOYSA-N | | SMILES | C(NC1=CC=CC=C1OC(C)=O)(=O)C |
| | 2-Aminophenol-N,O-diacetate Usage And Synthesis |
| Synthesis | The synthesis of 2-AMINOPHENOL-N,O-DIACETATE is as follows:The substrate (alcohol, phenol or amine; 1.0 mmol) was treated with Ac2O (2.0 mmol) in the presence of P(4-VPH)ClO4 (50 mg) at room temperature under solvent-free conditions and magnetic stirring. After completion of the reaction as indicated by TLC, the mixture was diluted with Et2O (25 ml) and the catalyst allowed to settle down. The supernatant ethereal solution was decanted off, the catalyst washed with Et2O (2 ml) and the combined ethereal solution concentrated under vacuum to afford the product, identical(mp, IR, 1H and 13C NMR, and GC-MS) to an authentic sample of acetylated product. The recovered catalyst was dried at 50 °C under vacuum for 2 h. The recovered catalyst, after drying, was reused for four more consecutive acetylation reactions of benzyl alcohol (1.0 mmol) affording 96, 96, 94, and 94% yields.
 |
| | 2-Aminophenol-N,O-diacetate Preparation Products And Raw materials |
|