|
|
| | Acetic acid 2-oxo-1,2-dihydro-quinolin-8-yl ester Basic information |
| Product Name: | Acetic acid 2-oxo-1,2-dihydro-quinolin-8-yl ester | | Synonyms: | AKOS AU36-M363;(2-oxo-1H-quinolin-8-yl) acetate;(2-oxo-1H-quinolin-8-yl) ethanoate;2-Oxo-1,2-dihydro-8-quinolinyl acetate;8-Acetoxy carbostyril;acetic acid (2-keto-1H-quinolin-8-yl) ester;acetic acid (2-oxo-1H-quinolin-8-yl) ester;2(1H)-Quinolinone,8-(acetyloxy)- | | CAS: | 15450-72-3 | | MF: | C11H9NO3 | | MW: | 203.19 | | EINECS: | | | Product Categories: | | | Mol File: | 15450-72-3.mol |  |
| | Acetic acid 2-oxo-1,2-dihydro-quinolin-8-yl ester Chemical Properties |
| Melting point | 247.5-248.5 °C | | Boiling point | 415.1±45.0 °C(Predicted) | | density | 1.272±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 10.91±0.70(Predicted) | | color | Light Beige to Beige | | InChI | 1S/C11H9NO3/c1-7(13)15-9-4-2-3-8-5-6-10(14)12-11(8)9/h2-6H,1H3,(H,12,14) | | InChIKey | UTMRKCQYCLEKDL-UHFFFAOYSA-N | | SMILES | CC(OC1=C2C(C=CC(O)=N2)=CC=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | Acetic acid 2-oxo-1,2-dihydro-quinolin-8-yl ester Usage And Synthesis |
| Uses | 8-Acetoxycarbostyril is an intermediate in the synthesis of metabolites of procaterol hydrochloride (Meptin) (P155490), a β2-adrenergic agonist used in the treatment of asthma. |
| | Acetic acid 2-oxo-1,2-dihydro-quinolin-8-yl ester Preparation Products And Raw materials |
|