- Dehydro Felodipine
-
- $1.36
-
2022-02-25
- CAS:96382-71-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 30tons
- Dehydro Felodipine
-
- $1.00
-
2022-02-25
- CAS:96382-71-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 30tons
|
| | Dehydro felodipine-13C4 Basic information |
| Product Name: | Dehydro felodipine-13C4 | | Synonyms: | 4-(2,3-Dichlorophenyl)-2,6-dimethyl-3,5-pyridinedicarboxylic Acid Ethyl Methyl Ester;H 152/3;H 152/37;4-(2,3-Dichlorophenyl)-2,6-dimethyl-3,5-pyridinedicarboxylic acid 5-ethyl 3-methyl ester;4-(2,3-Dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylic acid 3-ethyl 5-methyl ester;Felodipine EP IMpurity A;3-Ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate;Felodipine impurity A (EP) -C | | CAS: | 96382-71-7 | | MF: | C18H17Cl2NO4 | | MW: | 382.24 | | EINECS: | | | Product Categories: | Various Metabolites and Impurities;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 96382-71-7.mol |  |
| | Dehydro felodipine-13C4 Chemical Properties |
| Melting point | 70-73C | | Boiling point | 444.8±45.0 °C(Predicted) | | density | 1.288±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Very Slightly), Water (Slightly) | | form | Solid | | pka | 1.48±0.29(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C18H17Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8H,5H2,1-4H3 | | InChIKey | REQRUBNOOIAHMG-UHFFFAOYSA-N | | SMILES | Clc1c(cccc1c2c(c(nc(c2C(=O)OC)C)C)C(=O)OCC)Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 STOT RE 2 Inhalation |
| | Dehydro felodipine-13C4 Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | Dehydro Felodipine (Felodipine EP Impurity A) is the primary metabolite of Felodipine. | | Definition | ChEBI: Dehydrofelodipine is a phenylpyridine. |
| | Dehydro felodipine-13C4 Preparation Products And Raw materials |
|