Potassium tris(1-pyrazolyl)borohydride manufacturers
|
| | Potassium tris(1-pyrazolyl)borohydride Basic information |
| | Potassium tris(1-pyrazolyl)borohydride Chemical Properties |
| Melting point | 182-188 °C | | storage temp. | 2-8°C | | Water Solubility | Slightly soluble in water | | form | Crystalline Powder | | color | White | | InChI | 1S/C9H10BN6.K/c1-4-11-14(7-1)10(15-8-2-5-12-15)16-9-3-6-13-16;/h1-10H;/q-1;+1 | | InChIKey | IBNGZWIUPDMZMG-UHFFFAOYSA-N | | SMILES | [K+].c1cnn(c1)[BH-](n2cccn2)n3cccn3 |
| Hazard Codes | Xi-F,Xi | | Risk Statements | 36/37/38-15 | | Safety Statements | 8-43A-37/39-26 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29331990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Potassium tris(1-pyrazolyl)borohydride Usage And Synthesis |
| Chemical Properties | white crystalline powder | | reaction suitability | reagent type: ligand |
| | Potassium tris(1-pyrazolyl)borohydride Preparation Products And Raw materials |
|