| Company Name: |
Rhawn Reagent Gold |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
Salicyl fluorone manufacturers
- Salicyl fluorone
-
- $1.00
-
2024-07-20
- CAS:3569-82-2
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
- Salicyl fluorone
-
- $1.00
-
2020-01-13
- CAS:3569-82-2
- Min. Order: 1KG
- Purity: 98%-99.9%
- Supply Ability: 100kg
|
| | Salicyl fluorone Basic information |
| Product Name: | Salicyl fluorone | | Synonyms: | o-Hydroxyphenylfluorone;Salicyl fluorone;2-Hydroxyphenylfluorone;9-hydroxyphenylfluoron;9-(2-Hydroxyphenyl)-2,3,7-trihydroxyfluorone;3H-Xanthen-3-one,2,6,7-trihydroxy-9-(2-hydroxyphenyl)-;2,6,7-Trihydroxy-9-(2'-hydroxyphenyl)-3-fluorone;SKL173 | | CAS: | 3569-82-2 | | MF: | C19H12O6 | | MW: | 336.3 | | EINECS: | | | Product Categories: | | | Mol File: | 3569-82-2.mol |  |
| | Salicyl fluorone Chemical Properties |
| Boiling point | 689.5±55.0 °C(Predicted) | | density | 1.70±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 7.47±0.20(Predicted) | | Appearance | Brown to red Solid | | InChI | InChI=1S/C19H12O6/c20-12-4-2-1-3-9(12)19-10-5-13(21)15(23)7-17(10)25-18-8-16(24)14(22)6-11(18)19/h1-8,20-23H | | InChIKey | GRWQEXZZWRVXDZ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2O)C2=C(C=C(O)C(O)=C2)OC2C=1C=C(O)C(=O)C=2 |
| | Salicyl fluorone Usage And Synthesis |
| | Salicyl fluorone Preparation Products And Raw materials |
|