|
|
| | Doxefazepam Basic information |
| Product Name: | Doxefazepam | | Synonyms: | doxefaxepam;Doxefazepam;1,3-Dihydro-7-chloro-5-(o-fluorophenyl)-3-hydroxy-1-(2-hydroxyethyl)-2H-1,4-benzodiazepin-2-one;7-Chloro-5-(2-fluorophenyl)-1,3-dihydro-3-hydroxy-1-(2-hydroxyethyl)-2H-1,4-benzodiazepin-2-one;Doxans;SAS-643;Doxefazepam USP/EP/BP;DUFLURAZEPAM | | CAS: | 40762-15-0 | | MF: | C17H14ClFN2O3 | | MW: | 348.76 | | EINECS: | | | Product Categories: | | | Mol File: | 40762-15-0.mol |  |
| | Doxefazepam Chemical Properties |
| Melting point | 138-140° | | Boiling point | 204.52°C (rough estimate) | | density | 1.3534 (estimate) | | storage temp. | Store at -20°C | | pka | 11.55±0.40(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C17H14ClFN2O3/c18-10-5-6-14-12(9-10)15(11-3-1-2-4-13(11)19)20-16(23)17(24)21(14)7-8-22/h1-6,9,16,22-23H,7-8H2 | | InChIKey | VOJLELRQLPENHL-UHFFFAOYSA-N | | SMILES | N1(CCO)C2=CC=C(Cl)C=C2C(C2=CC=CC=C2F)=NC(O)C1=O | | IARC | 3 (Vol. 66) 1996 |
| RIDADR | 3249 | | HazardClass | 6.1(b) | | PackingGroup | III | | Toxicity | LD50 in rats, mice (mg/kg): 2550, >1500 orally; 586, 774 i.p. (Babbini) |
| | Doxefazepam Usage And Synthesis |
| Description | Doxefazepam is a benzodiazepine hypnotic somewhat more potent than flurazepam. | | Originator | Schiapparelli (Italy) | | Definition | ChEBI: Doxefazepam is a benzodiazepine. | | Brand name | DOXANS |
| | Doxefazepam Preparation Products And Raw materials |
|