- 5-bromoquinolin-8-ol
-
- $1.10
-
2025-11-18
- CAS:1198-14-7
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
- 5-Bromo-8-quinolinol
-
- $100.00
-
2025-06-20
- CAS:1198-14-7
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20 tons
|
| | 5-bromoquinolin-8-ol Basic information |
| | 5-bromoquinolin-8-ol Chemical Properties |
| Melting point | 127 °C | | Boiling point | 362.7±22.0 °C(Predicted) | | density | 1.5708 (rough estimate) | | refractive index | 1.6120 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 3.77±0.10(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C9H6BrNO/c10-7-3-4-8(12)9-6(7)2-1-5-11-9/h1-5,12H | | InChIKey | WIIUANWSGSTCLG-UHFFFAOYSA-N | | SMILES | N1C2C(=C(Br)C=CC=2O)C=CC=1 |
| RTECS | VC4582000 | | HS Code | 2933499090 |
| | 5-bromoquinolin-8-ol Usage And Synthesis |
| | 5-bromoquinolin-8-ol Preparation Products And Raw materials |
|