| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
geranyl valerate manufacturers
|
| | geranyl valerate Basic information |
| Product Name: | geranyl valerate | | Synonyms: | geranylvalerate,geranylpentanoate;Pentanoic acid, (2E)-3,7-dimethyl-2,6-octadienyl ester;Geranyl pentanoate;Pentanoic acid (E)-3,7-dimethyl-2,6-octadienyl ester;Valeric acid (E)-3,7-dimethyl-2,6-octadiene-1-yl ester;Valeric acid (E)-3,7-dimethyl-2,6-octadienyl ester;(E)-3,7-Dimethyl-2,6-octadienyl pentanoate;Ai3-24389 | | CAS: | 10402-47-8 | | MF: | C15H26O2 | | MW: | 238.37 | | EINECS: | 233-869-1 | | Product Categories: | | | Mol File: | 10402-47-8.mol |  |
| | geranyl valerate Chemical Properties |
| Boiling point | 316.8±21.0 °C(Predicted) | | density | 0.894±0.06 g/cm3(Predicted) | | FEMA | 4123 | GERANYL VALERATE | | Odor | at 100.00 %. rose fruity pineapple | | Odor Type | floral | | JECFA Number | 1821 | | Major Application | flavors and fragrances | | InChI | 1S/C15H26O2/c1-5-6-10-15(16)17-12-11-14(4)9-7-8-13(2)3/h8,11H,5-7,9-10,12H2,1-4H3/b14-11+ | | InChIKey | CVSWGLSBJFKWMW-SDNWHVSQSA-N | | SMILES | O(C\C=C(\CCC=C(C)C)/C)C(=O)CCCC | | LogP | 5.70 | | EPA Substance Registry System | Pentanoic acid, (2E)-3,7-dimethyl-2,6-octadienyl ester (10402-47-8) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | geranyl valerate Usage And Synthesis |
| Chemical Properties | Colorless liquid; fruity pineapple aroma. | | Occurrence | Reported found in geranium leaf oil, India (0 22%), geranium oil, Rwanda (0 18%), geranium petiole oil, India (0 37%), geranium stem oil, India (0 11%) and sassafras leaves | | Uses | flavors and fragrances | | Aroma threshold values | Medium strength odor, foral type. |
| | geranyl valerate Preparation Products And Raw materials |
|