| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | β-Nicotinamide adenine dinucleotide phosphate sodium salt Basic information |
| Product Name: | β-Nicotinamide adenine dinucleotide phosphate sodium salt | | Synonyms: | B-NICOTINAMIDE ADENINE DINUCLEOTIDE*PHOS PHATE SODIU;Triphosphopyridine nucleotide hydrate sodium salt;β-Nicotinamide adenine dinucleotide phosphate hydrate sodium salt;Nicotinamide adenine dinucleotide phosphate >98% (oxidised form) monosodium salt hydrate;β-Nicotinamide-Adenine Dinucleotide Phosphate, Oxidized Form (β-NADP-K);Coenzyme II Sodium Salt Hydrate;β-Nicotinamide adenine dinucleotide phosphate sodium salt;β-NADP/TPN | | CAS: | 698999-85-8 | | MF: | C21H27N7O17P3.Na.H2O | | MW: | 783.403 | | EINECS: | 621-861-4 | | Product Categories: | | | Mol File: | 698999-85-8.mol |  |
| | β-Nicotinamide adenine dinucleotide phosphate sodium salt Chemical Properties |
| Melting point | 175-178 °C (dec.)(lit.) | | storage temp. | -20°C | | solubility | H2O: soluble50mg/mL, clear, colorless to faintly yellow | | form | powder | | color | white to yellow | | Water Solubility | H2O: soluble 50mg/mL, clear, colorless to faintly yellow | | InChIKey | CYQLUFJYVTUUFN-WUEGHLCSSA-M | | SMILES | O[C@H]1[C@@H](O)[C@H]([N+]2=CC(C(N)=O)=CC=C2)O[C@@H]1COP(OP(OC[C@H]3O[C@@H](N(C=N4)C5=C4C(N)=NC=N5)[C@H](OP(O)(O)=O)[C@@H]3O)([O-])=O)([O-])=O.O.[Na+] |
| | β-Nicotinamide adenine dinucleotide phosphate sodium salt Usage And Synthesis |
| Uses | β-Nicotinamide adenine dinucleotide 2′-phosphate (NADP+) and β-Nicotinamide adenine dinucleotide 2′-phosphate, reduced (NADPH) comprise a coenzyme redox pair (NADP+:NADPH) involved in a wide range of enzyme catalyzed oxidation reduction reactions. The NADP+/NADPH redox pair facilitates electron transfer in anabolic reactions such as lipid and cholesterol biosynthesis and fatty acyl chain elongation. The NADP+/NADPH redox pair is used in a variety of antioxidation mechanism where it protects agains reactive oxidation species accumulation. NADPH is generated in vivio by the pentose phosphate pathway (PPP). | | Biochem/physiol Actions | Electron acceptor | | IC 50 | Human Endogenous Metabolite |
| | β-Nicotinamide adenine dinucleotide phosphate sodium salt Preparation Products And Raw materials |
|