O-(2-AZIDOETHYL)-O-(2-(DIGLYCOLYL-AMINO)ETHYL)EG-7 manufacturers
|
| | O-(2-AZIDOETHYL)-O-(2-(DIGLYCOLYL-AMINO)ETHYL)EG-7 Basic information |
| Product Name: | O-(2-AZIDOETHYL)-O-(2-(DIGLYCOLYL-AMINO)ETHYL)EG-7 | | Synonyms: | O-(2-Azidoethyl)-O-[2-(diglycoly-amino)ethyl]heptaethylene glycol;N-(PEG)-COOH (33 atoms);O-(2-AZIDOETHYL)-O-(2-(DIGLYCOLYL-AMINO)ETHYL)EG-7;azido-peg-acid (n=8);N3-(PEG)7-COOH;N-(PEG)-COOH (33 atoms) Novabiochem;2-((Azido-PEG8-carbamoyl)methoxy)acetic acid;O-(2-Azidoethyl)-O-[2-(diglycolyl-aMino)ethyl]heptaethylene glycol >=90% (oligoMer purity) | | CAS: | 846549-37-9 | | MF: | C22H42N4O12 | | MW: | 554.59 | | EINECS: | | | Product Categories: | peg | | Mol File: | 846549-37-9.mol |  |
| | O-(2-AZIDOETHYL)-O-(2-(DIGLYCOLYL-AMINO)ETHYL)EG-7 Chemical Properties |
| storage temp. | Store at +2°C to +8°C. | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C22H42N4O12/c23-26-25-2-4-31-6-8-33-10-12-35-14-16-37-18-17-36-15-13-34-11-9-32-7-5-30-3-1-24-21(27)19-38-20-22(28)29/h1-20H2,(H,24,27)(H,28,29) | | InChIKey | WWDNBBVPYDZICO-UHFFFAOYSA-N | | SMILES | C(CNC(=O)COCC(=O)O)OCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 25 | | WGK Germany | 3 | | HS Code | 2929 90 00 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | O-(2-AZIDOETHYL)-O-(2-(DIGLYCOLYL-AMINO)ETHYL)EG-7 Usage And Synthesis |
| Description | 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a PEG linker containing an azide group with a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | O-(2-AZIDOETHYL)-O-(2-(DIGLYCOLYL-AMINO)ETHYL)EG-7 Preparation Products And Raw materials |
|