- AEEA-AEEA
-
-
2026-10-10
- CAS:1143516-05-5
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 9999
- AEEA-AEEA
-
-
2026-07-24
- CAS:1143516-05-5
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | AEEA-AEEA Basic information | | Purity |
| Product Name: | AEEA-AEEA | | Synonyms: | AEEA-AEEA;8-Amino-3,6-dioxaoctanoic acid dimer≥ 98% (HPLC);H-Adoa-Adoa-OH;17-amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecan-1-oic acid;[2-(2-{2-[2-(2-amino-ethoxy)-ethoxy]-acetylamino}-ethoxy)-ethoxy]-acetic acid;17-amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadeca;3,6,12,15-Tetraoxa-9-azaheptadecanoic acid, 17-amino-10-oxo-;H-Ado-Ado-OH | | CAS: | 1143516-05-5 | | MF: | C12H24N2O7 | | MW: | 308.33 | | EINECS: | | | Product Categories: | 1143516-05-5;ADC LINKER | | Mol File: | 1143516-05-5.mol |  |
| | AEEA-AEEA Chemical Properties |
| Melting point | 133 - 135°C | | Boiling point | 548.7±50.0 °C(Predicted) | | density | 1.202±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly) | | pka | 3.39±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C12H24N2O7/c13-1-3-18-5-7-20-9-11(15)14-2-4-19-6-8-21-10-12(16)17/h1-10,13H2,(H,14,15)(H,16,17) | | InChIKey | YQZVQKYXWPIKIX-UHFFFAOYSA-N | | SMILES | C(O)(=O)COCCOCCNC(=O)COCCOCCN | | CAS DataBase Reference | 1143516-05-5 |
| | AEEA-AEEA Usage And Synthesis |
| Purity | 99% | | Description |
17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid (AEEA-AEEA) is a Semaglutide intermediate used in the preparation of glutamate-containing acylation reagents, as well as in the selective acylation of amino groups in peptides or proteins.
| | Chemical Properties | At room temperature, AEEA-AEEA is typically a white to off-white crystalline powder with a melting point of 133 to 135 °C. Its predicted boiling point is approximately 548.7 °C, and its predicted density is approximately 1.202 g/cm³. This compound has some solubility in dimethyl sulfoxide (DMSO) and methanol, but the solubility is low and usually requires heating or ultrasonic treatment. | | Uses | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid is used for preparation of glutamic acid-containing acylating reagents for selective acylation of amino group(s) in peptides or proteins. | | Uses | AEEA-AEEA (CAS 1143516-05-5) is a high-purity ADC and PROTAC hydrophilic linker, which can be used as a core unit in the synthesis of tirzepatide and semaglutide. This compound contains an amide bond, which functions to facilitate peptide bond formation. | | Application | AEEA-AEEA has significant application value in the field of targeted drug development, especially in the synthesis of antibody-drug conjugates (ADCs). As a non-cleavable linker, it can be used to link antibodies and cytotoxic drugs to improve drug stability and targeting. | | Synthesis | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid is synthesized by Hydrolysis Reaction of 12,12-Dimethyl-10-oxo-3,6,11-trioxa-9-azatridecanoic acid with Hydrolysis Reaction in Dichloromethane for 2h. |
| | AEEA-AEEA Preparation Products And Raw materials |
|