- Boc-2-Abu-ol
-
- $1.00
-
2020-01-06
- CAS:150736-72-4
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | N-BOC-(S)-2-AMINO-1-BUTANOL, 96% Basic information |
| | N-BOC-(S)-2-AMINO-1-BUTANOL, 96% Chemical Properties |
| Melting point | 40-45 °C | | Fp | 110 °C | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | Optical Rotation | -26.8°(C=0.01g/ml CHCL3) | | InChI | 1S/C9H19NO3/c1-5-7(6-11)10-8(12)13-9(2,3)4/h7,11H,5-6H2,1-4H3,(H,10,12)/t7-/m0/s1 | | InChIKey | LQRGWGOFPUXNOV-ZETCQYMHSA-N | | SMILES | CC[C@@H](CO)NC(=O)OC(C)(C)C |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2923 8/PG 3 | | WGK Germany | 1 | | HazardClass | 8, 6.1 | | HS Code | 2924190090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B |
| | N-BOC-(S)-2-AMINO-1-BUTANOL, 96% Usage And Synthesis |
| | N-BOC-(S)-2-AMINO-1-BUTANOL, 96% Preparation Products And Raw materials |
|