| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Bromo-3-iodotoluene Basic information |
| | 4-Bromo-3-iodotoluene Chemical Properties |
| Boiling point | 271.5±20.0℃ (760 Torr) | | density | 2.084 g/mL at 25 °C | | refractive index | n20/D 1.646 | | Fp | 110 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Very Dark Brown | | InChI | InChI=1S/C7H6BrI/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 | | InChIKey | FLOUOTRVXNQGKP-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(C)C=C1I |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2903998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 |
| | 4-Bromo-3-iodotoluene Usage And Synthesis |
| Chemical Properties | Red Liquid | | Uses | 1-Bromo-2-iodo-4-methylbenzene is a reagent used in pharmaceutical synthesis as well in the synthesis of graphene nanoribbons with near-infrared absorption. |
| | 4-Bromo-3-iodotoluene Preparation Products And Raw materials |
|