- Benzocyclobutenone
-
-
2025-04-04
- CAS:3469-06-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- Benzocyclobutenone
-
- $2.15
-
2024-08-02
- CAS:3469-06-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | Benzocyclobutenone Basic information | | Uses |
| | Benzocyclobutenone Chemical Properties |
| Boiling point | 71-72 °C(Press: 2 Torr) | | density | 1.214±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | liquid | | color | Colourless | | InChI | InChI=1S/C8H6O/c9-8-5-6-3-1-2-4-7(6)8/h1-4H,5H2 | | InChIKey | XOGFXHMYHKGOGP-UHFFFAOYSA-N | | SMILES | C12C(C(=O)C1)=CC=CC=2 | | NIST Chemistry Reference | Benzocyclobutenone(3469-06-5) |
| | Benzocyclobutenone Usage And Synthesis |
| Uses | Benzocyclobutenone is commonly used as an organic reagent and participates in a variety of chemical reactions, such as carbonylation, oxidation, and addition reactions. | | Chemical Properties | Yellow crystals |
| | Benzocyclobutenone Preparation Products And Raw materials |
|