|
|
| | 1-(2-Dimethylaminoethyl)piperazine Basic information |
| Product Name: | 1-(2-Dimethylaminoethyl)piperazine | | Synonyms: | N,N-DIMETHYL-1-PIPERAZINEETHANAMINE;N,N-DIMETHYL-2-PIPERAZINOETHYLAMINE;RARECHEM AH CK 0089;TIMTEC-BB SBB010067;1-(2-Dimethylaminoethyl)piperazine 97%;1-Piperazineethanamine,N,N-dimethyl-(9CI);1-[2-(DIMETHYLAMINO)-ETHYL]-PIPERAZINE >98%;N,N-Dimethyl-1-piperazineethanamine, N,N-Dimethyl-2-piperazinoethylamine | | CAS: | 3644-18-6 | | MF: | C8H19N3 | | MW: | 157.26 | | EINECS: | | | Product Categories: | PIPERIDINE | | Mol File: | 3644-18-6.mol |  |
| | 1-(2-Dimethylaminoethyl)piperazine Chemical Properties |
| Boiling point | 63 °C | | density | 0.92g/ml | | refractive index | n20/D 1.479 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.50±0.28(Predicted) | | form | liquid | | color | Colourless | | BRN | 105841 | | InChI | InChI=1S/C8H19N3/c1-9-3-4-11-7-5-10(2)6-8-11/h9H,3-8H2,1-2H3 | | InChIKey | LZEBHQQBLHMJOG-UHFFFAOYSA-N | | SMILES | N1(CCNC)CCN(C)CC1 | | CAS DataBase Reference | 3644-18-6(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | F | 10-34 | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 1-(2-Dimethylaminoethyl)piperazine Usage And Synthesis |
| Chemical Properties | Clear yellow liquid |
| | 1-(2-Dimethylaminoethyl)piperazine Preparation Products And Raw materials |
|