Dimethyl 3-oxoadipate manufacturers
|
| | Dimethyl 3-oxoadipate Basic information |
| Product Name: | Dimethyl 3-oxoadipate | | Synonyms: | Hexanedioic acid, 3-oxo-, dimethyl ester;3-OXOHEXANEDIOIC ACID DIMETHYL ESTER;BETA-KETOADIPIC ACID DIMETHYL ESTER;DIMETHYL BETA-KETOADIPATE;3-ketoadipic acid dimethyl ester;DIMETHYL 3-OXODIPATE;1,6-diMethyl 3-oxohexanedioate;Hexanedioic acid,3-oxo-, 1,6-dimethyl ester||| | | CAS: | 5457-44-3 | | MF: | C8H12O5 | | MW: | 188.18 | | EINECS: | 226-716-5 | | Product Categories: | | | Mol File: | 5457-44-3.mol |  |
| | Dimethyl 3-oxoadipate Chemical Properties |
| Boiling point | 122 °C(Press: 0.5 Torr) | | density | 1.175 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.444 | | storage temp. | Store at room temperature | | pka | 10.15±0.46(Predicted) | | Appearance | Light yellow to yellow Liquid | | InChI | InChI=1S/C8H12O5/c1-12-7(10)4-3-6(9)5-8(11)13-2/h3-5H2,1-2H3 | | InChIKey | CMGTZMRSJJKAPM-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CC(=O)CCC(OC)=O |
| | Dimethyl 3-oxoadipate Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 22, p. 848, 1957 DOI: 10.1021/jo01358a620
Synthesis, p. 568, 1999 |
| | Dimethyl 3-oxoadipate Preparation Products And Raw materials |
|