Methylenecyclohexaneoxide manufacturers
|
| | Methylenecyclohexaneoxide Basic information |
| Product Name: | Methylenecyclohexaneoxide | | Synonyms: | Methylenecyclohexaneoxide;OXASPIROOCTANE;1-OXASPIRO(2.5)OCTANE;Spiro[cyclohexane-1,2'-oxirane];Inchi=1/C7H12o/C1-2-4-7(5-3-1)6-8-7/H1-6h;2-methylene-1-cyclohexanolate | | CAS: | 185-70-6 | | MF: | C7H12O | | MW: | 112.17 | | EINECS: | | | Product Categories: | | | Mol File: | 185-70-6.mol |  |
| | Methylenecyclohexaneoxide Chemical Properties |
| Boiling point | 103-104 °C | | density | 0.98±0.1 g/cm3(Predicted) |
| RIDADR | 1993 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 2932990090 |
| | Methylenecyclohexaneoxide Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 92, p. 5753, 1970 DOI: 10.1021/ja00722a047
Organic Syntheses, Coll. Vol. 5, p. 755, 1973 |
| | Methylenecyclohexaneoxide Preparation Products And Raw materials |
|