| Company Name: |
Hangzhou Sage Chemical Co., Ltd.
|
| Tel: |
+86057186818502 13588463833 |
| Email: |
info@sagechem.com |
| Products Intro: |
Product Name:Cholestan-3-ol, 5,6-epoxy-, (3b,5b,6b)-
CAS:4025-59-6
Purity:98% Package:1g;5g;100g;Bulk
|
| Company Name: |
Codow Chemical Co.,Ltd.
|
| Tel: |
18620099427 |
| Email: |
amy@howeipharm.com |
| Products Intro: |
Product Name:cholestanol, 5?,6?-epoxy
CAS:4025-59-6
Purity:>99% Package:1MG;2.5MG;5MG;10MG;25MG
|
|
| | 5BETA,6BETA-EPOXYCHOLESTAN-3BETA-OL Basic information |
| Product Name: | 5BETA,6BETA-EPOXYCHOLESTAN-3BETA-OL | | Synonyms: | 5,6-beta-epoxy-5-beta-cholestan-3-beta-o;5,6-epoxy-,(3-beta,5-beta,6-beta)-cholestan-3-o;cholesterolbeta-epoxide;CHOLESTAN-5-BETA, 6-BETA-EPOXY-3-BETA-OL;CHOLESTEROL-5BETA,6BETA-EPOXIDE;CHOLESTERYL -BETA-EPOXIDE;BETA-EPOXYCHOLESTEROL;cholesterol-5B,6B-epoxide | | CAS: | 4025-59-6 | | MF: | C27H46O2 | | MW: | 402.65 | | EINECS: | | | Product Categories: | | | Mol File: | 4025-59-6.mol |  |
| | 5BETA,6BETA-EPOXYCHOLESTAN-3BETA-OL Chemical Properties |
| storage temp. | room temp | | solubility | DMF: 2 mg/ml; DMSO: 0.1 mg/ml; Ethanol: 20 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml | | form | A crystalline solid | | color | White to off-white | | InChI | 1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-20-15-24-27(29-24)16-19(28)11-14-26(27,5)23(20)12-13-25(21,22)4/h17-24,28H,6-16H2,1-5H3 | | InChIKey | PRYIJAGAEJZDBO-UHFFFAOYSA-N | | SMILES | [H][C@@]12[C@]([C@](CC[C@H](O)C3)(C)[C@]3(O4)[C@H]4C2)([H])CC[C@@]5(C)[C@@]1([H])CC[C@]5([H])[C@]([H])(C)CCCC(C)C |
| | 5BETA,6BETA-EPOXYCHOLESTAN-3BETA-OL Usage And Synthesis |
| Uses | Cholesterol 5beta,6beta-epoxide is an oxysterol produced as an oxidation product of cholesterol. | | Definition | ChEBI: Cholesterol beta-epoxide is 5,6beta-epoxy-5beta-cholestan-3beta-ol It is a 3beta-hydroxy steroid, an oxysterol and an epoxy steroid. It derives from a hydride of a 5beta-cholestane. | | Biological Activity | Cholesterol 5β,6β-epoxide is an oxysterol produced as an oxidation product of cholesterol. Oxysterols are cytotoxic and induce death in monocytes, smooth muscle cells and endothelial cells. The mechanism of apoptosis induced by oxysterols may involve caspases or DNA fragmentation. |
| | 5BETA,6BETA-EPOXYCHOLESTAN-3BETA-OL Preparation Products And Raw materials |
|