|
|
| | 4-(3-chlorophenyl)butanoicacid Basic information |
| Product Name: | 4-(3-chlorophenyl)butanoicacid | | Synonyms: | 4-(3-chlorophenyl)butanoicacid;Benzenebutanoic acid, 3-chloro-;3-Chlorophenylbutanoic acid;3-Chlorobenzenebutanoic acid;4-(3-Chloro-phenyl)-butyric acid | | CAS: | 22991-05-5 | | MF: | C10H11ClO2 | | MW: | 198.65 | | EINECS: | | | Product Categories: | | | Mol File: | 22991-05-5.mol |  |
| | 4-(3-chlorophenyl)butanoicacid Chemical Properties |
| Melting point | 55-56 °C | | Boiling point | 323.0±17.0 °C(Predicted) | | density | 1.227±0.06 g/cm3(Predicted) | | pka | 4.73±0.10(Predicted) | | InChI | InChI=1S/C10H11ClO2/c11-9-5-1-3-8(7-9)4-2-6-10(12)13/h1,3,5,7H,2,4,6H2,(H,12,13) | | InChIKey | UKSCUPNTXJMPCO-UHFFFAOYSA-N | | SMILES | C1(CCCC(O)=O)=CC=CC(Cl)=C1 |
| | 4-(3-chlorophenyl)butanoicacid Usage And Synthesis |
| | 4-(3-chlorophenyl)butanoicacid Preparation Products And Raw materials |
|