| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 6-chloro-N4-cyclopentylpyrimidine-4,5-diamine Basic information |
| Product Name: | 6-chloro-N4-cyclopentylpyrimidine-4,5-diamine | | Synonyms: | 6-chloro-N4-cyclopentylpyrimidine-4,5-diamine;(5-amino-6-chloro-pyrimidin-4-yl)-cyclopentyl-amine;6-chloro-4-N-cyclopentylpyrimidine-4,5-diamine;(2-(4-CHLOROPHENYL)-7-METHYL-5-OXOIMIDAZO[1,2-A]PYRIMIDIN-8(5H)-YL)ACETIC ACID;4,5-Pyrimidinediamine, 6-chloro-N4-cyclopentyl-;6-Chloro-N~4~-cyclopentyl-4,5-pyrimidinediamine | | CAS: | 5452-43-7 | | MF: | C9H13ClN4 | | MW: | 212.68 | | EINECS: | | | Product Categories: | | | Mol File: | 5452-43-7.mol |  |
| | 6-chloro-N4-cyclopentylpyrimidine-4,5-diamine Chemical Properties |
| form | powder | | InChI | 1S/C9H13ClN4/c10-8-7(11)9(13-5-12-8)14-6-3-1-2-4-6/h5-6H,1-4,11H2,(H,12,13,14) | | InChIKey | HPFRDZDLWJMHNH-UHFFFAOYSA-N | | SMILES | ClC1=C(N)C(NC2CCCC2)=NC=N1 |
| Storage Class | 11 - Combustible Solids |
| | 6-chloro-N4-cyclopentylpyrimidine-4,5-diamine Usage And Synthesis |
| | 6-chloro-N4-cyclopentylpyrimidine-4,5-diamine Preparation Products And Raw materials |
|