| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Triethyl-d15-amine Basic information |
| | Triethyl-d15-amine Chemical Properties |
| Melting point | -115 °C(lit.) | | Boiling point | 88.8 °C(lit.) | | density | 0.835 g/mL | | refractive index | n20/D 1.396(lit.) | | Fp | 20 °F | | solubility | Methanol (Slightly) | | form | Liquid | | color | Colourless | | InChI | 1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3/i1D3,2D3,3D3,4D2,5D2,6D2 | | InChIKey | ZMANZCXQSJIPKH-NLBPYYKNSA-N | | SMILES | [2H]C([2H])(C([2H])([2H])[2H])N(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 121-44-8 |
| Hazard Codes | F,C | | Risk Statements | 11-20/21/22-35 | | Safety Statements | 3-16-26-29-36/37/39-45 | | RIDADR | UN 1296 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1A STOT SE 3 |
| | Triethyl-d15-amine Usage And Synthesis |
| | Triethyl-d15-amine Preparation Products And Raw materials |
|