|
|
| | Ethyl-d5-amine Basic information |
| | Ethyl-d5-amine Chemical Properties |
| InChI | 1S/C2H7N/c1-2-3/h2-3H2,1H3/i1D3,2D2 | | InChIKey | QUSNBJAOOMFDIB-ZBJDZAJPSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])N | | CAS Number Unlabeled | 75-04-7 |
| WGK Germany | WGK 1 | | Storage Class | 2A - Gases | | Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Flam. Gas 1 Press. Gas Liquefied gas STOT SE 3 |
| | Ethyl-d5-amine Usage And Synthesis |
| | Ethyl-d5-amine Preparation Products And Raw materials |
|