|
|
| | 10-Oxo Morphine Basic information |
| Product Name: | 10-Oxo Morphine | | Synonyms: | (5a,6a)-7,8-Didehydro-4,5-epoxy-3,6-dihydroxy-17-methylmorphinan-10-on;10-Oxo Morphine;10-Oxomorphine (10-Ketomorphine);10-Ketomorphine;10-Oxomorphine solution;(5a,6a)-7,8-Didehydro-4,5-epoxy-3,6-dihydroxy-17-methylmorphinan-10-one;Morphinan-10-one, 7,8-didehydro-4,5-epoxy-3,6-dihydroxy-17-methyl-, (5α,6α)-;10-Oxo Morphine (100μg/ml in Methanol) | | CAS: | 68254-48-8 | | MF: | C17H17NO4 | | MW: | 299.33 | | EINECS: | 200-659-6 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Chiral Reagents;Heterocycles;Impurities | | Mol File: | 68254-48-8.mol |  |
| | 10-Oxo Morphine Chemical Properties |
| Boiling point | 557.0±50.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | Fp | 9℃ | | storage temp. | -20°C | | pka | 7.25±0.40(Predicted) | | form | liquid | | Major Application | forensics and toxicology | | InChI | 1S/C17H17NO4/c1-18-7-6-17-9-3-5-11(20)16(17)22-15-10(19)4-2-8(12(15)17)14(21)13(9)18/h2-5,9,11,13,16,19-20H,6-7H2,1H3/t9-,11-,13-,16-,17-/m0/s1 | | InChIKey | HNJBQZPKNKFLFM-CBEJNMEVSA-N | | SMILES | CN1CC[C@]23[C@H]4Oc5c(O)ccc(C(=O)[C@@H]1[C@@H]2C=C[C@@H]4O)c35 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | 10-Oxo Morphine Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Controlled Substance. A decomposition product of Morphine | | Uses | 10-Oxo Morphine is a decomposition product of Morphine (M652290). Morphine impurity.
Controlled substance. | | General Description | A certified solution standard of the decomposition product measured in manufactured morphine sulfate drug products or APIs using LC or LC/MS. |
| | 10-Oxo Morphine Preparation Products And Raw materials |
|