| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,5-difluorobenzophenone Basic information |
| Product Name: | 3,5-difluorobenzophenone | | Synonyms: | 3,5-DIFLUOROBENZOPHENONE;3,5-Difluorobenzophenone 97%;3,5-Difluorobenzophenone97%;3,5-DIFLUOROBENZOPHENONE, 98+%;(3,5-Difluorophenyl)(phenyl)methanone;Methanone, (3,5-difluorophenyl)phenyl- | | CAS: | 179113-89-4 | | MF: | C13H8F2O | | MW: | 218.2 | | EINECS: | 642-490-4 | | Product Categories: | | | Mol File: | 179113-89-4.mol |  |
| | 3,5-difluorobenzophenone Chemical Properties |
| Melting point | 57-59°C | | Boiling point | 117°C 5mm | | density | 1.239±0.06 g/cm3(Predicted) | | Fp | 116-118°C/5mm | | storage temp. | 2-8°C | | form | crystalline solid | | color | Yellow | | BRN | 7919206 | | InChI | InChI=1S/C13H8F2O/c14-11-6-10(7-12(15)8-11)13(16)9-4-2-1-3-5-9/h1-8H | | InChIKey | PNRLNUIMFIMZLI-UHFFFAOYSA-N | | SMILES | C(C1=CC(F)=CC(F)=C1)(C1=CC=CC=C1)=O | | CAS DataBase Reference | 179113-89-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2914390090 |
| Provider | Language |
|
ALFA
| English |
| | 3,5-difluorobenzophenone Usage And Synthesis |
| Preparation | Synthesis of 3,5-Difluorobenzophenone: Prior to acylations, 3,5-difluorobenzoic acid was reacted with freshly distilled thionyl chloride and catalytic amounts of DMF(2 drops). After two hours at 55 °C, the excess thionyl chloride was distilled between 75 and 77 °C. The acid halide was then fractionally distilled at 174 °C, and recovery was generally around 75%. To a 50 mL round bottom flask, equipped with a gas inlet, addition funnel, condenser, and drying tube, were added 3.01 g (22.6 mmol) of AlCl3. A mixture of 3.62 g (20.5 mmol) 3,5-difluorobenzoyl chloride and 8.01 g (102.5 mmol) benzene was added dropwise to the AlCl3. The reaction mixture was stirred for 4 hours, before heating to 75 °C. After 16 hours the reaction mixture was quenched by pouring into acidic ice water, followed by addition of 300 mL of chloroform, and transferring to a separatory funnel. The layers were separated and the organic layer was washed with 5 wt. % bicarbonate, distilled water, and then dried with MgSO4 and the solvents were removed, via rotary evaporation, leaving an off-white solid. The crude material was recrystallized from aqueous ethanol to afford (3.00 g, 67 %) of a crystalline white solid with a m.p. 58-59 °C (lit.21 m.p. 57-58 °C); 1H NMR (300 MHz, CDCl3, δ) 7.04 (tt, 1H, J = 8.4, 2.4 Hz), 7.31 (m, 2H), 7.51 (m, 2H), 7.63 (tt, 1H, J = 7.5, 1.2 Hz), 7.78 (m, 2H) |
| | 3,5-difluorobenzophenone Preparation Products And Raw materials |
|