|
|
| | 1-[(4-Chlorophenyl)phenylmethyl]-piperazine dihydrochloride Basic information |
| Product Name: | 1-[(4-Chlorophenyl)phenylmethyl]-piperazine dihydrochloride | | Synonyms: | 1-((4-chlorophenyl)phenylmethyl)-piperazinhydrochloride;1-(alpha-(4-chlorophenyl)benzyl)-piperazinhydrochloride;1-(p-chloro-alpha-phenylbenzyl)-piperazinhydrochloride;norchlorcyclizinehydrochloride;1-[(4-chlorophenyl)benzyl]piperazine hydrochloride;1-[(4-Chlorophenyl)benzyl]piperazine dihydrochloride;Einecs 242-526-5;Piperazine, 1-((4-chlorophenyl)phenylmethyl)-, hydrochloride | | CAS: | 18719-22-7 | | MF: | C17H19ClN2.2ClH | | MW: | 359.73 | | EINECS: | 242-526-5 | | Product Categories: | | | Mol File: | 18719-22-7.mol | ![1-[(4-Chlorophenyl)phenylmethyl]-piperazine dihydrochloride Structure](CAS/GIF/18719-22-7.gif) |
| | 1-[(4-Chlorophenyl)phenylmethyl]-piperazine dihydrochloride Chemical Properties |
| solubility | Aqueous Acid (Sparingly), Water (Slightly) | | form | Solid | | color | Off-White to Pale Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C17H19ClN2.2ClH/c18-16-8-6-15(7-9-16)17(14-4-2-1-3-5-14)20-12-10-19-11-13-20;;/h1-9,17,19H,10-13H2;2*1H | | InChIKey | LBFBMRCUZCPOAO-UHFFFAOYSA-N | | SMILES | C(N1CCNCC1)(C1=CC=CC=C1)C1C=CC(Cl)=CC=1.Cl.Cl |
| | 1-[(4-Chlorophenyl)phenylmethyl]-piperazine dihydrochloride Usage And Synthesis |
| Uses | 1-[(4-Chlorophenyl)phenylmethyl]piperazine Hydrochloride is a useful research chemical compound used in the preparation of phenylindoles as 5-HT2A receptor ligands. | | Safety Profile | An experimental teratogen.Experimental reproductive effects. When heated todecomposition it emits toxic fumes of NOx and Clí. |
| | 1-[(4-Chlorophenyl)phenylmethyl]-piperazine dihydrochloride Preparation Products And Raw materials |
|