| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | mono(2-ethyl-5-oxohexyl)phthalate Basic information |
| Product Name: | mono(2-ethyl-5-oxohexyl)phthalate | | Synonyms: | mono(2-ethyl-5-oxohexyl)phthalate;rac Mono(2-ethyl-5-oxohexyl) Phthalate;1,2-Benzenedicarboxylic Acid 1-(2-Ethyl-5-oxohexyl) Ester;2-Ethyl-5-oxohexyl Phthalate;5-Oxo-MEHP;Phthalic Acid Mono(2-ethyl-5-oxohexyl) Ester;mono-[(2RS)-2-Ethyl-5-oxohexyl] phthalate;Mono(2-ethyl-5-oxohexyl) phthalate (MEOHP) | | CAS: | 40321-98-0 | | MF: | C16H20O5 | | MW: | 292.33 | | EINECS: | | | Product Categories: | Aromatics;Metabolites & Impurities | | Mol File: | 40321-98-0.mol |  |
| | mono(2-ethyl-5-oxohexyl)phthalate Chemical Properties |
| Boiling point | 478.7±30.0 °C(Predicted) | | density | 1.155±0.06 g/cm3(Predicted) | | refractive index | n20/D 1.516-1.518 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Hexanes (Slightly), Methanol (Slightly) | | form | Oil | | pka | 3.37±0.36(Predicted) | | color | Yellow to Brown | | BRN | 920863 | | Major Application | cleaning products
cosmetics
environmental
food and beverages
personal care | | InChI | 1S/C16H20O5/c1-3-12(9-8-11(2)17)10-21-16(20)14-7-5-4-6-13(14)15(18)19/h4-7,12H,3,8-10H2,1-2H3,(H,18,19) | | InChIKey | HCWNFKHKKHNSSL-UHFFFAOYSA-N | | SMILES | O=C(OCC(CC)CCC(C)=O)C1=CC=CC=C1C(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | mono(2-ethyl-5-oxohexyl)phthalate Usage And Synthesis |
| Chemical Properties | Brown Liquid | | Uses | A phthalate metabolite. Prenatal phthalate exposure could have potential neurological effects in humans and animals. | | Definition | ChEBI: A phthalic acid monoester obtained by formal condensation of one of the carboxy groups of phthalic acid with the hydroxy group of 2-ethyl-5-oxohexan-1-ol. |
| | mono(2-ethyl-5-oxohexyl)phthalate Preparation Products And Raw materials |
|