|
|
| Product Name: | 2,2-Dimethylglutaric anhydride | | Synonyms: | 2H-Pyran-2,6(3H)-dione, dihydro-3,3-dimethyl-;ALPHA,ALPHA-DIMETHYLGLUTARIC ANHYDRIDE;dihydro-3,3-dimethyl-2H-pyran-2,6(3H)-dione;2,2-DIMETHYLGLUTARIC ANHYDRIDE 98%;3,3-dimethyltetrahydro-2H-pyran-2,6-dione;2,2-Dimethylglutaric anhydride,98%;2,2-Dimethylglutaric Anhydride >;2,2-dimethylglutaric acid anhydride | | CAS: | 2938-48-9 | | MF: | C7H10O3 | | MW: | 142.15 | | EINECS: | 220-922-9 | | Product Categories: | Anhydride Monomers;Monomers;Polymer Science;1 | | Mol File: | 2938-48-9.mol |  |
| | 2,2-Dimethylglutaric anhydride Chemical Properties |
| Melting point | 34-38 °C (lit.) | | Boiling point | 175-180 °C/60 mmHg (lit.) | | density | 1.1643 (rough estimate) | | refractive index | 1.4730 (estimate) | | Fp | >230 °F | | form | powder to lump | | color | White to Almost white | | Sensitive | Moisture Sensitive | | BRN | 117056 | | InChI | InChI=1S/C7H10O3/c1-7(2)4-3-5(8)10-6(7)9/h3-4H2,1-2H3 | | InChIKey | PAVNZLVXYJDFNR-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)CCC1(C)C | | CAS DataBase Reference | 2938-48-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29171990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2-Dimethylglutaric anhydride Usage And Synthesis |
| Synthesis | 2,2-Dimethylglutaric anhydride can be obtained by reacting 2,2-dimethylglutaric acid with a condensing agent. 
2,2-Dimethylglutaric acid (3.00 g, 18.7 mmol) was added to a solution of EDCI (3.95 g, 20.6 mmol) and triethylamine (2.87 mL, 20.6 mmol) in dichloromethane (360 mL), and the reaction mixture was stirred for 18 h at room temperature. The solution was washed with saturated NaHCO3 aqueous solution (2×100 mL) and water (1×100 mL). The organic layer was dried over anhydrous magnesium sulfate, filtered, and concentrated. The crude product was purified by rapid silica gel chromatography using ethyl acetate and hexane (30:70) as eluent to give a white solid (1.88 g, 71%). | | Uses | 2,2-Dimethylglutaric anhydride is an organic intermediate, and some literature reports that 2,2-dimethylglutaric anhydride can be used to prepare a high molecular weight aliphatic polyester. | | Chemical Properties | white crystals or crystalline powder |
| | 2,2-Dimethylglutaric anhydride Preparation Products And Raw materials |
|