|
|
| | Dimercaptosuccinic acid Basic information |
| Product Name: | Dimercaptosuccinic acid | | Synonyms: | 2,3-dimercapto-butanedioicaci;2,3-dimercaptobutanedioicacid;2,2-Dimercaptosuccinic acid;2,3-dimercapto-succinicaci;alpha,beta-dimercaptosuccinicacid;suximer;2,3-DIMERCAPTOSUCCINIC ACID;DIMERCAPTOSUCCINIC ACID | | CAS: | 2418-14-6 | | MF: | C4H6O4S2 | | MW: | 182.22 | | EINECS: | 219-334-5 | | Product Categories: | bc0001 | | Mol File: | 2418-14-6.mol |  |
| | Dimercaptosuccinic acid Chemical Properties |
| Melting point | 196-198°C | | Boiling point | 285.62°C (rough estimate) | | density | 1.439 (estimate) | | refractive index | 1.5220 (estimate) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly) | | pka | 2.74±0.25(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Air Sensitive, Stench, Unstable in DMSO | | InChI | InChI=1S/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8) | | InChIKey | ACTRVOBWPAIOHC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(S)C(S)C(O)=O | | CAS DataBase Reference | 2418-14-6(CAS DataBase Reference) | | EPA Substance Registry System | Butanedioic acid, 2,3-dimercapto- (2418-14-6) |
| | Dimercaptosuccinic acid Usage And Synthesis |
| Uses | 2,3-Dimercaptosuccinic Acid is used as a chelator in the treatment of mercury and lead poisonings. |
| | Dimercaptosuccinic acid Preparation Products And Raw materials |
|