|
|
| | oxoglaucine Basic information |
| Product Name: | oxoglaucine | | Synonyms: | oxoglaucine;1,2,9,10-Tetramethoxy-7H-dibenzo[de,g]quinolin-7-one;O-Methylatheroline;7H-Dibenzo[de,g]quinolin-7-one, 1,2,9,10-tetramethoxy-;oxoglaucine USP/EP/BP | | CAS: | 5574-24-3 | | MF: | C20H17NO5 | | MW: | 351.35 | | EINECS: | | | Product Categories: | | | Mol File: | 5574-24-3.mol |  |
| | oxoglaucine Chemical Properties |
| Melting point | 227-229℃ (chloroform methanol ) | | Boiling point | 577.9±50.0 °C(Predicted) | | density | 1.310±0.06 g/cm3 (20 ºC 760 Torr) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 1.93±0.20(Predicted) | | InChI | InChI=1S/C20H17NO5/c1-23-13-8-11-12(9-14(13)24-2)19(22)18-16-10(5-6-21-18)7-15(25-3)20(26-4)17(11)16/h5-9H,1-4H3 | | InChIKey | ZYKCETVKVRJFGD-UHFFFAOYSA-N | | SMILES | N1C2=C3C(=C(OC)C(OC)=CC3=CC=1)C1=CC(OC)=C(OC)C=C1C2=O |
| | oxoglaucine Usage And Synthesis |
| Description | An alkaloid isolated from Annona purpurea, O-methylatheroline contains four
methoxyl groups in the molecule. Physiologically, it has been found to be cytotoxic
to 9-KB experimental tumours. | | Chemical Properties | Soluble in organic solvents such as methanol, ethanol, and DMSO. | | Definition | ChEBI: Oxoglaucine is an isoquinoline alkaloid. | | References | Sonnet, Jacobson,J. Pharm. Sci., 60, 1254 (1971) |
| | oxoglaucine Preparation Products And Raw materials |
| Raw materials | 7H-Dibenzo[de,g]quinolinium, 1-hydroxy-2,9,10-trimethoxy-6-methyl-7-oxo-, inner salt-->6'-bromodihydropapaverine-->Pyrrolo[2,1-a]isoquinoline-2,3-dione, 1-(2-bromo-4,5-dimethoxyphenyl)-5,6-dihydro-8,9-dimethoxy--->(+/-)-Tetrahydropapaverine | | Preparation Products | Dehydroglaucine |
|