4-trans-Ethylcyclohexylbromobenzene manufacturers
|
| | 4-trans-Ethylcyclohexylbromobenzene Basic information | | Uses |
| Product Name: | 4-trans-Ethylcyclohexylbromobenzene | | Synonyms: | 4-trans-Ethylcyclohexylbromobenzene;1-BROMO-4-(TRANS-4-ETHYLCYCLOHEXYL)BENZENE;BENZENE, 1-BROMO-4-(4-ETHYLCYCLOHEXYL)-, TRANS-;trans-1-BroMo-4-(4-ethylcyclohexyl)benzene, 97%;4-trans(4-ethyl cyclohexyl) bromobenzene;1-bromo-2-((1r,4r)-4-ethylcyclohexyl)benzene;4-trans-Ethylcyclohexylbromobenzene ISO 9001：2015 REACH;1-bromo-4-((1r,4r)-4-ethylcyclohexyl)benzene | | CAS: | 91538-82-8 | | MF: | C14H19Br | | MW: | 267.2 | | EINECS: | 422-030-7 | | Product Categories: | | | Mol File: | 91538-82-8.mol |  |
| | 4-trans-Ethylcyclohexylbromobenzene Chemical Properties |
| Boiling point | 336.2℃[at 101 325 Pa] | | density | 1.324[at 20℃] | | vapor pressure | 0.005Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Solid-liquid mixture | | InChI | InChI=1S/C14H19Br/c1-2-11-3-5-12(6-4-11)13-7-9-14(15)10-8-13/h7-12H,2-6H2,1H3/t11-,12- | | InChIKey | UZNPLXSOLSAKGB-HAQNSBGRSA-N | | SMILES | C1(Br)=CC=C([C@@H]2CC[C@@H](CC)CC2)C=C1 | | LogP | 8 at 20℃ |
| | 4-trans-Ethylcyclohexylbromobenzene Usage And Synthesis |
| Uses | trans-1-bromo-4-(4-ethylcyclohexane)-benzene can be used as an intermediate in liquid crystal materials. | | Flammability and Explosibility | Not classified |
| | 4-trans-Ethylcyclohexylbromobenzene Preparation Products And Raw materials |
|