| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyl 4-chloro-6-methylquinoline-3-carboxylate Basic information |
| Product Name: | Ethyl 4-chloro-6-methylquinoline-3-carboxylate | | Synonyms: | 4-Chloro-6-methylquinoline-3-carboxylic acid ethyl ester;4-chloro-6-methylquinoline-3-carboxylic acid;4-Chloro-6-methyl-3-quinolinecarboxylic acid ethyl ester;3-Quinolinecarboxylic acid, 4-chloro-6-methyl-, ethyl ester | | CAS: | 56824-87-4 | | MF: | C13H12ClNO2 | | MW: | 249.69 | | EINECS: | | | Product Categories: | | | Mol File: | 56824-87-4.mol |  |
| | Ethyl 4-chloro-6-methylquinoline-3-carboxylate Chemical Properties |
| Melting point | 64-66℃ | | Boiling point | 346.4±37.0 °C(Predicted) | | density | 1.252 | | storage temp. | Store at room temperature | | form | solid | | pka | 2.01±0.27(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C13H12ClNO2/c1-3-17-13(16)10-7-15-11-5-4-8(2)6-9(11)12(10)14/h4-7H,3H2,1-2H3 | | InChIKey | GSIDXMVQPNWNIR-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(C)=CC=2)C(Cl)=C(C(OCC)=O)C=1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Ethyl 4-chloro-6-methylquinoline-3-carboxylate Usage And Synthesis |
| | Ethyl 4-chloro-6-methylquinoline-3-carboxylate Preparation Products And Raw materials |
|