| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Chloro-6-methylquinoline Basic information |
| Product Name: | 4-Chloro-6-methylquinoline | | Synonyms: | 4-CHLORO-6-METHYLQUINOLINE;4-Chloro-6-methylquinoline >Quinoline, 4-chloro-6-methyl-;4-Chloro-6-methylquinoline ISO 9001:2015 REACH;4-chloro-6-methylquinoline - [C71820] | | CAS: | 18436-71-0 | | MF: | C10H8ClN | | MW: | 177.63 | | EINECS: | 803-344-7 | | Product Categories: | | | Mol File: | 18436-71-0.mol |  |
| | 4-Chloro-6-methylquinoline Chemical Properties |
| Melting point | 51.0 to 55.0 °C | | Boiling point | 140°C/10mmHg(lit.) | | density | 1.225±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.79±0.16(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C10H8ClN/c1-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-6H,1H3 | | InChIKey | HZWWPOQFLMUYOX-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(C)=CC=2)C(Cl)=CC=1 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4-Chloro-6-methylquinoline Usage And Synthesis |
| Uses |
4-Chloro-6-methylquinoline is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
| | Application | 4-Chloro-6-methylquinoline is also a key intermediate in the synthesis of the anticancer drug lenvatinib, which is used to treat unresectable hepatocellular carcinoma. |
| | 4-Chloro-6-methylquinoline Preparation Products And Raw materials |
|