|
|
| | 2-Bromo-6-iodo-benzoic acid
Basic information | | Uses |
| | 2-Bromo-6-iodo-benzoic acid
Chemical Properties |
| Boiling point | 352.7±37.0 °C(Predicted) | | density | 2.331±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 1.51±0.10(Predicted) | | form | solid | | color | White to yellow | | InChI | InChI=1S/C7H4BrIO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11) | | InChIKey | PTQGEYMPMWQTDM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(I)C=CC=C1Br |
| | 2-Bromo-6-iodo-benzoic acid
Usage And Synthesis |
| Uses | 2-Bromo-6-iodobenzoic acid is a carboxylic acid and can be used as an intermediate in pharmaceutical synthesis. |
| | 2-Bromo-6-iodo-benzoic acid
Preparation Products And Raw materials |
|