|
|
| | 3-BROMO-PYRAZOLO[1,5-A]PYRIMIDINE Basic information |
| | 3-BROMO-PYRAZOLO[1,5-A]PYRIMIDINE Chemical Properties |
| Melting point | 158-159℃ | | density | 1.89 | | storage temp. | Sealed in dry,Room Temperature | | pka | -1.25±0.40(Predicted) | | form | solid | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C6H4BrN3/c7-5-4-9-10-3-1-2-8-6(5)10/h1-4H | | InChIKey | MFJWRPLBWPDHGV-UHFFFAOYSA-N | | SMILES | C12=C(Br)C=NN1C=CC=N2 |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-BROMO-PYRAZOLO[1,5-A]PYRIMIDINE Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 3-bromopyrazolo[1,5-a]pyrimidines from pyrazolo[1,5-a]pyrimidines: pyrazolo[1,5-a]pyrimidines (1 g, 8.39 mmol) were dissolved in acetonitrile (5 mL), followed by addition of N-bromosuccinimide (NBS, 1.494 g, 8.39 mmol). The reaction mixture was stirred at room temperature for 8 hours. + (calculated value C6H5BrN3: 198.0); LC-MS retention time (Method A2): tR = 1.43 min. | | References | [1] Patent: WO2017/59080, 2017, A1. Location in patent: Page/Page column 256; 257 |
| | 3-BROMO-PYRAZOLO[1,5-A]PYRIMIDINE Preparation Products And Raw materials |
|