|
|
| | 4-Iodobenzeneboronic acid pinacol ester, 97% Basic information |
| Product Name: | 4-Iodobenzeneboronic acid pinacol ester, 97% | | Synonyms: | 4-Iodobenzeneboronic acid pinacol ester, 97%;2-(4-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;4-Iodophenylboronic acid pinacol ester;4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)iodobenzene;1,3,2-Dioxaborolane, 2-(4-iodophenyl)-4,4,5,5-tetramethyl-;4-Iodobenzeneboronic acid pinacol ester | | CAS: | 73852-88-7 | | MF: | C12H16BIO2 | | MW: | 329.97 | | EINECS: | | | Product Categories: | | | Mol File: | 73852-88-7.mol |  |
| | 4-Iodobenzeneboronic acid pinacol ester, 97% Chemical Properties |
| Melting point | 101-105 °C | | Boiling point | 341.1±25.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder | | Appearance | White to off-white Solid | | Sensitive | Light Sensitive | | InChI | 1S/C12H16BIO2/c1-11(2)12(3,4)16-13(15-11)9-5-7-10(14)8-6-9/h5-8H,1-4H3 | | InChIKey | ACCWXFPZHMACEN-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccc(I)cc2 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 4-Iodobenzeneboronic acid pinacol ester, 97% Usage And Synthesis |
| Uses | 4-Iodophenylboronic acid, pinacol ester |
| | 4-Iodobenzeneboronic acid pinacol ester, 97% Preparation Products And Raw materials |
|