|
|
| | 6-Chloro-2-hydroxy-quinoline-4-carboxylic acid Basic information |
| | 6-Chloro-2-hydroxy-quinoline-4-carboxylic acid Chemical Properties |
| Melting point | 280 °C | | Boiling point | 434.408±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.550±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | pka | 2.409±0.20(predicted) | | InChI | InChI=1S/C10H6ClNO3/c11-5-1-2-8-6(3-5)7(10(14)15)4-9(13)12-8/h1-4H,(H,12,13)(H,14,15) | | InChIKey | AMYRRFUUZGORKF-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Cl)C=C2)C(C(O)=O)=CC1=O |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 6-Chloro-2-hydroxy-quinoline-4-carboxylic acid Usage And Synthesis |
| Uses |
6-CHLORO-2-HYDROXY-QUINOLINE-4-CARBOXYLIC ACID can be used in pharmaceutical synthesis and scientific research.
|
| | 6-Chloro-2-hydroxy-quinoline-4-carboxylic acid Preparation Products And Raw materials |
|