| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-Adamantylzinc bromide Basic information |
| Product Name: | 2-Adamantylzinc bromide | | Synonyms: | 2-ADAMANTYLZINC BROMIDE, 0.5M SOLUTION I;2-adamantylzinc bromide solution;2-Adamantylzinc bromide solution 0.5M in THF;2-Adamantylzinc bromide 0.5 M in Tetrahydrofuran;2-Adamantylzinc bromide solution 0.5 in THF;2-AdaMantylzinc broMide, 0.5M in THF, packaged under Argon in resealable CheMSeal^t bottles;2-Adamantylzinc bromide, 0.5M in THF, packaged under Argon in resealable ChemSeal™2-Adamantylzinc bromide | | CAS: | 171860-65-4 | | MF: | C10H15BrZn | | MW: | 280.53 | | EINECS: | | | Product Categories: | Alkyl;Organozinc Halides;Reike and Organozinc Reagents | | Mol File: | 171860-65-4.mol |  |
| | 2-Adamantylzinc bromide Chemical Properties |
| Boiling point | 65 °C | | density | 1.018 g/mL at 25 °C | | Fp | 1 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Yellow to brown to black | | Water Solubility | Reacts with water. | | Sensitive | Air Sensitive | | InChI | 1S/C10H15.BrH.Zn/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1,7-10H,2-6H2;1H;/q;;+1/p-1/t7-,8+,9-,10+;; | | InChIKey | HHXSMOCPPVCAHH-DHNWFJROSA-M | | SMILES | Br[Zn]C1[C@H]2C[C@@H]3C[C@H](C2)C[C@H]1C3 |
| Hazard Codes | F,Xn | | Risk Statements | 14-19-22-36/38-40-36/37-11 | | Safety Statements | 16-26-33-36-36/37 | | RIDADR | UN 2056 3/PG 2 | | WGK Germany | 1 | | HazardClass | 4.3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Carc. 2
Eye Irrit. 2
Flam. Liq. 2
STOT SE 3 |
| | 2-Adamantylzinc bromide Usage And Synthesis |
| Uses | 2-Adamantylzinc bromide used as a intermediate for pharmaceutical. |
| | 2-Adamantylzinc bromide Preparation Products And Raw materials |
|