1,3-DIBENZOYLBENZENE manufacturers
|
| | 1,3-DIBENZOYLBENZENE Basic information |
| | 1,3-DIBENZOYLBENZENE Chemical Properties |
| Melting point | 105-108 °C(lit.) | | Boiling point | 467.5±28.0 °C(Predicted) | | density | 1.165±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Sparingly Soluble (4.0E-3 g/L) (25°C). | | form | solid | | Appearance | Off-white to light yellow Solid | | BRN | 1973337 | | InChI | InChI=1S/C20H14O2/c21-19(15-8-3-1-4-9-15)17-12-7-13-18(14-17)20(22)16-10-5-2-6-11-16/h1-14H | | InChIKey | MJQHDSIEDGPFAM-UHFFFAOYSA-N | | SMILES | C1(C(C2=CC=CC=C2)=O)=CC=CC(C(C2=CC=CC=C2)=O)=C1 | | CAS DataBase Reference | 3770-82-9(CAS DataBase Reference) | | EPA Substance Registry System | Methanone, 1,3-phenylenebis[phenyl- (3770-82-9) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 1,3-DIBENZOYLBENZENE Usage And Synthesis |
| Uses | 1,3-Dibenzoylbenzene is suitable reagent used in the synthesis of 1,3-bis(1-phenylvinyl)benzene (MDDPE). It may be used in the synthesis of polyanionic spin-quintet molecular clusters and ground state undecet hydrocarbon with 10 parallel spins. | | Uses | 1,3-Dibenzoylbenzene ([3-(benzoyl)phenyl]-phenyl-methanone, m-Dibenzoylbenzene) is suitable reagent used in the synthesis of 1,3-bis(1-phenylvinyl)benzene (MDDPE). It may be used in the synthesis of polyanionic spin-quintet molecular clusters and ground state undecet hydrocarbon with 10 parallel spins. | | General Description | 1,3-Dibenzoylbenzene ([3-(benzoyl)phenyl]-phenyl-methanone, m-Dibenzoylbenzene) is a diarylketone derivative. It has topologically pseudogenerate Π-LUMO′s (lowest unoccupied molecular orbital). Its synthesis from benzene has been reported. Crystal structure studies suggest that its crystals are orthorhombic and exhibit space goup Pbca. |
| | 1,3-DIBENZOYLBENZENE Preparation Products And Raw materials |
|