1,3-BIS(4-FLUOROBENZOYL)BENZENE manufacturers
|
| | 1,3-BIS(4-FLUOROBENZOYL)BENZENE Basic information |
| Product Name: | 1,3-BIS(4-FLUOROBENZOYL)BENZENE | | Synonyms: | 1,3-BIS(4-FLUOROBENZ;1,3-Bis(4-Fluorobenzoyl)benzene (BFBZ);(4-fluorophenyl)({3-[(4-fluorophenyl)carbonyl]phenyl})Methanone;1,3-BIS(4-FLUOROBENZOYL)BENZENE;LABOTEST-BB LT00159359;1,3-Phenylenebis((4-fluorophenyl)Methanone);1,3-Bis(4-Fluorobenzoyl;1,3-Bis(4-fluorobenzoyl)benzene 98% | | CAS: | 108464-88-6 | | MF: | C20H12F2O2 | | MW: | 322.3 | | EINECS: | 1312995-182-4 | | Product Categories: | C15 to C38;Carbonyl Compounds;Ketones | | Mol File: | 108464-88-6.mol |  |
| | 1,3-BIS(4-FLUOROBENZOYL)BENZENE Chemical Properties |
| Melting point | 181-183 °C (lit.) | | Boiling point | 476.3±40.0 °C(Predicted) | | density | 1.268 | | storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C20H12F2O2/c21-17-8-4-13(5-9-17)19(23)15-2-1-3-16(12-15)20(24)14-6-10-18(22)11-7-14/h1-12H | | InChIKey | PISLKPDKKIDMQT-UHFFFAOYSA-N | | SMILES | C1(C(C2=CC=C(F)C=C2)=O)=CC=CC(C(C2=CC=C(F)C=C2)=O)=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1,3-BIS(4-FLUOROBENZOYL)BENZENE Usage And Synthesis |
| Uses | 1,3-Bis(4-fluorobenzoyl)benzene was used for the synthesis of sulfonated poly(aryl ether ketone)s (SPAEK) copolymers by aromatic nucleophilic polycondensation. It may be employed as an activated nonsulfonated difluoro-monomer for the synthesis of fluorenyl-containing sulfonated poly(aryl ether ether ketone ketone)s. | | General Description | 1,3-Bis(4-fluorobenzoyl)benzene is an organic building block. It polymerizes with 4,4′-isopropylidenediphenol (bisphenol-A) in the presence of N-methyl-2-pyrrolidinone (solvent) to afford high molecular weight polymers. |
| | 1,3-BIS(4-FLUOROBENZOYL)BENZENE Preparation Products And Raw materials |
|