|
|
| | 4-(Trifluoromethoxy)chlorobenzene Basic information |
| | 4-(Trifluoromethoxy)chlorobenzene Chemical Properties |
| Melting point | 51-53 | | Boiling point | 142 °C | | density | 1.367 | | refractive index | 1.436 | | Fp | 142-143°C | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.367 | | InChI | InChI=1S/C7H4ClF3O/c8-5-1-3-6(4-2-5)12-7(9,10)11/h1-4H | | InChIKey | SELFZOLQRDPBKC-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(OC(F)(F)F)C=C1 | | CAS DataBase Reference | 461-81-4(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 4-(Trifluoromethoxy)chlorobenzene Usage And Synthesis |
| Chemical Properties | Colorless transparent liquid |
| | 4-(Trifluoromethoxy)chlorobenzene Preparation Products And Raw materials |
|