| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dimethyl tetradecanedioate Basic information |
| Product Name: | Dimethyl tetradecanedioate | | Synonyms: | TETRADECANEDIOIC ACID DIMETHYL ESTER;Tetradecanedioic acid, 1,14-dimethyl ester;Dimcthyltetradecanedioate;Dimethyl tetradecanedioate | | CAS: | 5024-21-5 | | MF: | C16H30O4 | | MW: | 286.41 | | EINECS: | 225-711-5 | | Product Categories: | | | Mol File: | 5024-21-5.mol |  |
| | Dimethyl tetradecanedioate Chemical Properties |
| Melting point | 43 °C | | Boiling point | 196 °C / 10mmHg | | density | 0.955±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | very faint turbidity in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C16H30O4/c1-19-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(18)20-2/h3-14H2,1-2H3 | | InChIKey | ZDJFDFNNEAPGOP-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCCCCCCCCC(OC)=O | | EPA Substance Registry System | Tetradecanedioic acid, dimethyl ester (5024-21-5) |
| TSCA | TSCA listed | | HS Code | 2917.19.7050 |
| | Dimethyl tetradecanedioate Usage And Synthesis |
| Uses | Dimethyl tetradecanedioate (Tetradecanedioic Acid Dimethyl Ester) is an ester product. |
| | Dimethyl tetradecanedioate Preparation Products And Raw materials |
|