|
|
| | Dimethyl hexadecanedioate Basic information |
| Product Name: | Dimethyl hexadecanedioate | | Synonyms: | DIMETHYL-1,16-HEXADECANEDIOATE;1,14-Tetradecanedicarboxylic acid dimethyl ester;Dimethyl thapsate;Hexadecadioic acid, dimethyl ester;hexadecanedioic acid,dimethyl ester;DimethylHexadecanedioate>;Hexadecanedioic acid, 1,16-dimethyl ester;Dimethyl Hexadecandioante | | CAS: | 19102-90-0 | | MF: | C18H34O4 | | MW: | 314.46 | | EINECS: | | | Product Categories: | | | Mol File: | 19102-90-0.mol |  |
| | Dimethyl hexadecanedioate Chemical Properties |
| Melting point | 53 °C | | Boiling point | 172 °C / 1mmHg | | density | 0.945±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C18H34O4/c1-21-17(19)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(20)22-2/h3-16H2,1-2H3 | | InChIKey | MQIZSSSBYFJIJF-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCCCCCCCCCCC(OC)=O | | LogP | 5.958 (est) | | CAS DataBase Reference | 19102-90-0 |
| | Dimethyl hexadecanedioate Usage And Synthesis |
| Uses | Dimethyl hexadecanedioate (Hexadecanedioic acid,dimethyl ester) is an ester product. |
| | Dimethyl hexadecanedioate Preparation Products And Raw materials |
|