| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4,4'-Diisothiocyanatodiphenylmethane Basic information |
| | 4,4'-Diisothiocyanatodiphenylmethane Chemical Properties |
| Melting point | 139-143 °C(lit.) | | Boiling point | 453.7±38.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C15H10N2S2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h1-8H,9H2 | | InChIKey | MPNVWXWBSJKVDD-UHFFFAOYSA-N | | SMILES | S=C=Nc1ccc(Cc2ccc(cc2)N=C=S)cc1 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-42 | | Safety Statements | 23-26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |
| | 4,4'-Diisothiocyanatodiphenylmethane Usage And Synthesis |
| | 4,4'-Diisothiocyanatodiphenylmethane Preparation Products And Raw materials |
|